C7H13N — CID 125040803
(1S,3R,6R)-bicyclo[4.1.0]heptan-3-amine (PubChem CID 125040803) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is (1S,3R,6R)-bicyclo[4.1.0]heptan-3-amine.
| Compound Name | (1S,3R,6R)-bicyclo[4.1.0]heptan-3-amine |
|---|---|
| PubChem CID | 125040803 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | (1S,3R,6R)-bicyclo[4.1.0]heptan-3-amine |
| SMILES | N[C@@H]1CC[C@@H]2C[C@H]2C1 |
| InChI | InChI=1S/C7H13N/c8-7-2-1-5-3-6(5)4-7/h5-7H,1-4,8H2/t5-,6+,7-/m1/s1 |
| InChIKey | UFGBMEFPOGIKLC-DSYKOEDSSA-N |
| XLogP | 1.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |