About tricyclo[4.2.1.12,4]decan-5-amine
tricyclo[4.2.1.12,4]decan-5-amine (PubChem CID 123976925) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is tricyclo[4.2.1.12,4]decan-5-amine.
Molecular Properties
| Compound Name | tricyclo[4.2.1.12,4]decan-5-amine |
| PubChem CID | 123976925 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | tricyclo[4.2.1.12,4]decan-5-amine |
| SMILES | NC1C2CCC(C2)C2CC1C2 |
| InChI | InChI=1S/C10H17N/c11-10-7-2-1-6(3-7)8-4-9(10)5-8/h6-10H,1-5,11H2 |
| InChIKey | OTMOVYSISDAHRF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[4.2.1.12,4]decan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[4.2.1.12,4]decan-5-amine?
The IUPAC name of tricyclo[4.2.1.12,4]decan-5-amine (CID 123976925) is tricyclo[4.2.1.12,4]decan-5-amine.
What is the SMILES notation for tricyclo[4.2.1.12,4]decan-5-amine?
The canonical SMILES for tricyclo[4.2.1.12,4]decan-5-amine is NC1C2CCC(C2)C2CC1C2.
What is the InChIKey of tricyclo[4.2.1.12,4]decan-5-amine?
The InChIKey is OTMOVYSISDAHRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c11-10-7-2-1-6(3-7)8-4-9(10)5-8/h6-10H,1-5,11H2.
What are the key properties of tricyclo[4.2.1.12,4]decan-5-amine?
tricyclo[4.2.1.12,4]decan-5-amine has a molecular weight of 151.25 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[4.2.1.12,4]decan-5-amine is sourced from PubChem (CID 123976925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).