C14H27N — CID 155419218
(3R,13S)-bicyclo[11.1.0]tetradecan-3-amine (PubChem CID 155419218) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (3R,13S)-bicyclo[11.1.0]tetradecan-3-amine.
| Compound Name | (3R,13S)-bicyclo[11.1.0]tetradecan-3-amine |
|---|---|
| PubChem CID | 155419218 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (3R,13S)-bicyclo[11.1.0]tetradecan-3-amine |
| SMILES | N[C@@H]1CCCCCCCCC[C@H]2CC2C1 |
| InChI | InChI=1S/C14H27N/c15-14-9-7-5-3-1-2-4-6-8-12-10-13(12)11-14/h12-14H,1-11,15H2/t12-,13?,14+/m0/s1 |
| InChIKey | STYDXFARGSXXMY-SMEJFCCLSA-N |
| XLogP | 3.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |