C41H78NO7P — CID 140575503
2-azaniumylethoxy-[2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl]phosphinate (PubChem CID 140575503) has the molecular formula C41H78NO7P and a molecular weight of 728.05 g/mol. Its IUPAC name is 2-azaniumylethoxy-[2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl]phosphinate.
| Compound Name | 2-azaniumylethoxy-[2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl]phosphinate |
|---|---|
| PubChem CID | 140575503 |
| Molecular Formula | C41H78NO7P |
| Molecular Weight | 728.05 g/mol |
| Exact Mass | 727.55 |
| IUPAC Name | 2-azaniumylethoxy-[2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl]phosphinate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CP(=O)([O-])OCC[NH3+])OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C41H78NO7P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(43)47-37-39(38-50(45,46)48-36-35-42)49-41(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,39H,3-16,21-38,42H2,1-2H3,(H,45,46)/b19-17-,20-18- |
| InChIKey | OEODZXPJIBTEGU-CLFAGFIQSA-N |
| XLogP | 10.33 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.05 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|