C78H146NO12P — CID 159642655
azanium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] [(2S)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] phosphate (PubChem CID 159642655) has the molecular formula C78H146NO12P and a molecular weight of 1320.99 g/mol. Its IUPAC name is azanium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] [(2S)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] phosphate.
| Compound Name | azanium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] [(2S)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] phosphate |
|---|---|
| PubChem CID | 159642655 |
| Molecular Formula | C78H146NO12P |
| Molecular Weight | 1320.99 g/mol |
| Exact Mass | 1320.06 |
| IUPAC Name | azanium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] [(2S)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OC[C@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC.[NH4+] |
| InChI | InChI=1S/C78H143O12P.H3N/c1-5-9-13-17-21-25-29-33-37-41-45-49-53-57-61-65-75(79)85-69-73(89-77(81)67-63-59-55-51-47-43-39-35-31-27-23-19-15-11-7-3)71-87-91(83,84)88-72-74(90-78(82)68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-8-4)70-86-76(80)66-62-58-54-50-46-42-38-34-30-26-22-18-14-10-6-2;/h33-40,73-74H,5-32,41-72H2,1-4H3,(H,83,84);1H3/b37-33-,38-34-,39-35-,40-36-;/t73-,74+; |
| InChIKey | JKVJJSANRWKSFX-VTLALGFISA-N |
| XLogP | 23.92 |
| TPSA | 200.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 72 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1320.99 |
| LogP ≤ 5 | 23.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|