C38H70O12P- — CID 122371168
bis[2,3-di(octanoyloxy)propyl] phosphate (PubChem CID 122371168) has the molecular formula C38H70O12P- and a molecular weight of 749.94 g/mol. Its IUPAC name is bis[2,3-di(octanoyloxy)propyl] phosphate.
| Compound Name | bis[2,3-di(octanoyloxy)propyl] phosphate |
|---|---|
| PubChem CID | 122371168 |
| Molecular Formula | C38H70O12P- |
| Molecular Weight | 749.94 g/mol |
| Exact Mass | 749.46 |
| IUPAC Name | bis[2,3-di(octanoyloxy)propyl] phosphate |
| SMILES | CCCCCCCC(=O)OCC(COP(=O)([O-])OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC)OC(=O)CCCCCCC |
| InChI | InChI=1S/C38H71O12P/c1-5-9-13-17-21-25-35(39)45-29-33(49-37(41)27-23-19-15-11-7-3)31-47-51(43,44)48-32-34(50-38(42)28-24-20-16-12-8-4)30-46-36(40)26-22-18-14-10-6-2/h33-34H,5-32H2,1-4H3,(H,43,44)/p-1 |
| InChIKey | QPISZKLECGXTFC-UHFFFAOYSA-M |
| XLogP | 8.84 |
| TPSA | 163.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.94 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|