C23H43O8P-2 — CID 86289480
[(2R)-2,3-di(decanoyloxy)propyl] phosphate (PubChem CID 86289480) has the molecular formula C23H43O8P-2 and a molecular weight of 478.56 g/mol. Its IUPAC name is [(2R)-2,3-di(decanoyloxy)propyl] phosphate.
| Compound Name | [(2R)-2,3-di(decanoyloxy)propyl] phosphate |
|---|---|
| PubChem CID | 86289480 |
| Molecular Formula | C23H43O8P-2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [(2R)-2,3-di(decanoyloxy)propyl] phosphate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])[O-])OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C23H45O8P/c1-3-5-7-9-11-13-15-17-22(24)29-19-21(20-30-32(26,27)28)31-23(25)18-16-14-12-10-8-6-4-2/h21H,3-20H2,1-2H3,(H2,26,27,28)/p-2/t21-/m1/s1 |
| InChIKey | PHQFPHNJHDEXLJ-OAQYLSRUSA-L |
| XLogP | 4.57 |
| TPSA | 125.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|