C25H20FN5O6S — CID 140576130
[5-[4-[7-amino-2-(6-fluoro-1,3-benzothiazol-7-yl)furo[2,3-c]pyridin-4-yl]pyrazol-1-yl]-2-formyloxy-2-hydroxycyclohexyl] formate (PubChem CID 140576130) has the molecular formula C25H20FN5O6S and a molecular weight of 537.53 g/mol. Its IUPAC name is [5-[4-[7-amino-2-(6-fluoro-1,3-benzothiazol-7-yl)furo[2,3-c]pyridin-4-yl]pyrazol-1-yl]-2-formyloxy-2-hydroxycyclohexyl] formate.
| Compound Name | [5-[4-[7-amino-2-(6-fluoro-1,3-benzothiazol-7-yl)furo[2,3-c]pyridin-4-yl]pyrazol-1-yl]-2-formyloxy-2-hydroxycyclohexyl] formate |
|---|---|
| PubChem CID | 140576130 |
| Molecular Formula | C25H20FN5O6S |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | [5-[4-[7-amino-2-(6-fluoro-1,3-benzothiazol-7-yl)furo[2,3-c]pyridin-4-yl]pyrazol-1-yl]-2-formyloxy-2-hydroxycyclohexyl] formate |
| SMILES | Nc1ncc(-c2cnn(C3CCC(O)(OC=O)C(OC=O)C3)c2)c2cc(-c3c(F)ccc4ncsc34)oc12 |
| InChI | InChI=1S/C25H20FN5O6S/c26-17-1-2-18-23(38-10-29-18)21(17)19-6-15-16(8-28-24(27)22(15)37-19)13-7-30-31(9-13)14-3-4-25(34,36-12-33)20(5-14)35-11-32/h1-2,6-12,14,20,34H,3-5H2,(H2,27,28) |
| InChIKey | PJDUXPLTQAIFPD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 155.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|