About CID 140577195
CID 140577195 (PubChem CID 140577195) has the molecular formula C16H14BN4Y7-
and a molecular weight of 895.47 g/mol.
Molecular Properties
| Compound Name | CID 140577195 |
| PubChem CID | 140577195 |
| Molecular Formula | C16H14BN4Y7- |
| Molecular Weight | 895.47 g/mol |
| Exact Mass | 895.47 |
| IUPAC Name | — |
| SMILES | Cn1c([B-]c2nc3ccccc3n2C)nc2ccccc21.[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C16H14BN4.7Y/c1-20-13-9-5-3-7-11(13)18-15(20)17-16-19-12-8-4-6-10-14(12)21(16)2;;;;;;;/h3-10H,1-2H3;;;;;;;/q-1;;;;;;; |
| InChIKey | JUUUKLZXXYVUGS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 895.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140577195 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140577195?
The IUPAC name of CID 140577195 (CID 140577195) is not available.
What is the SMILES notation for CID 140577195?
The canonical SMILES for CID 140577195 is Cn1c([B-]c2nc3ccccc3n2C)nc2ccccc21.[Y].[Y].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of CID 140577195?
The InChIKey is JUUUKLZXXYVUGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BN4.7Y/c1-20-13-9-5-3-7-11(13)18-15(20)17-16-19-12-8-4-6-10-14(12)21(16)2;;;;;;;/h3-10H,1-2H3;;;;;;;/q-1;;;;;;;.
What are the key properties of CID 140577195?
CID 140577195 has a molecular weight of 895.47 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140577195 is sourced from PubChem (CID 140577195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).