C11H16N2O2 — CID 90743807
1,2-dimethylbenzimidazole;formaldehyde;methanol (PubChem CID 90743807) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1,2-dimethylbenzimidazole;formaldehyde;methanol.
| Compound Name | 1,2-dimethylbenzimidazole;formaldehyde;methanol |
|---|---|
| PubChem CID | 90743807 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1,2-dimethylbenzimidazole;formaldehyde;methanol |
| SMILES | C=O.CO.Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C9H10N2.CH4O.CH2O/c1-7-10-8-5-3-4-6-9(8)11(7)2;2*1-2/h3-6H,1-2H3;2H,1H3;1H2 |
| InChIKey | SBOHXXFPUMNSSB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |