C16H15F3N2O2 — CID 140578827
2-(2-ethoxyimino-3,3,3-trifluoropropyl)naphthalene-1-carboxamide (PubChem CID 140578827) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-(2-ethoxyimino-3,3,3-trifluoropropyl)naphthalene-1-carboxamide.
| Compound Name | 2-(2-ethoxyimino-3,3,3-trifluoropropyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140578827 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-(2-ethoxyimino-3,3,3-trifluoropropyl)naphthalene-1-carboxamide |
| SMILES | CCON=C(Cc1ccc2ccccc2c1C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O2/c1-2-23-21-13(16(17,18)19)9-11-8-7-10-5-3-4-6-12(10)14(11)15(20)22/h3-8H,2,9H2,1H3,(H2,20,22) |
| InChIKey | SBUMSADRNQGHLA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|