C9H4F6N2S — CID 140579512
5-thiophen-2-yl-1,3-bis(trifluoromethyl)pyrazole (PubChem CID 140579512) has the molecular formula C9H4F6N2S and a molecular weight of 286.20 g/mol. Its IUPAC name is 5-thiophen-2-yl-1,3-bis(trifluoromethyl)pyrazole.
| Compound Name | 5-thiophen-2-yl-1,3-bis(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 140579512 |
| Molecular Formula | C9H4F6N2S |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 5-thiophen-2-yl-1,3-bis(trifluoromethyl)pyrazole |
| SMILES | FC(F)(F)c1cc(-c2cccs2)n(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H4F6N2S/c10-8(11,12)7-4-5(6-2-1-3-18-6)17(16-7)9(13,14)15/h1-4H |
| InChIKey | OTFUYKIVOYYLDO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |