C22H16F3N3OS — CID 18832586
N-(3-methylphenyl)-4-[5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]benzamide (PubChem CID 18832586) has the molecular formula C22H16F3N3OS and a molecular weight of 427.45 g/mol. Its IUPAC name is N-(3-methylphenyl)-4-[5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]benzamide.
| Compound Name | N-(3-methylphenyl)-4-[5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 18832586 |
| Molecular Formula | C22H16F3N3OS |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-(3-methylphenyl)-4-[5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(-n3nc(C(F)(F)F)cc3-c3cccs3)cc2)c1 |
| InChI | InChI=1S/C22H16F3N3OS/c1-14-4-2-5-16(12-14)26-21(29)15-7-9-17(10-8-15)28-18(19-6-3-11-30-19)13-20(27-28)22(23,24)25/h2-13H,1H3,(H,26,29) |
| InChIKey | PJCMQZPJPCFQIE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |