C28H39NO4 — CID 140580261
[(13S)-17-acetyl-11-(4-aminocyclohexyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 140580261) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is [(13S)-17-acetyl-11-(4-aminocyclohexyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(13S)-17-acetyl-11-(4-aminocyclohexyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 140580261 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | [(13S)-17-acetyl-11-(4-aminocyclohexyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1(C(C)=O)CCC2C3CCC4=CC(=O)CCC4=C3C(C3CCC(N)CC3)C[C@@]21C |
| InChI | InChI=1S/C28H39NO4/c1-16(30)28(33-17(2)31)13-12-25-23-10-6-19-14-21(32)9-11-22(19)26(23)24(15-27(25,28)3)18-4-7-20(29)8-5-18/h14,18,20,23-25H,4-13,15,29H2,1-3H3/t18?,20?,23?,24?,25?,27-,28?/m0/s1 |
| InChIKey | HOFRKRUCNWYASQ-UJRNZREGSA-N |
| XLogP | 4.83 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |