C10H25N3O6S2 — CID 140581416
2-[3-(3-aminopropylamino)propyl-(2-sulfoethyl)amino]ethanesulfonic acid (PubChem CID 140581416) has the molecular formula C10H25N3O6S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[3-(3-aminopropylamino)propyl-(2-sulfoethyl)amino]ethanesulfonic acid.
| Compound Name | 2-[3-(3-aminopropylamino)propyl-(2-sulfoethyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 140581416 |
| Molecular Formula | C10H25N3O6S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-[3-(3-aminopropylamino)propyl-(2-sulfoethyl)amino]ethanesulfonic acid |
| SMILES | NCCCNCCCN(CCS(=O)(=O)O)CCS(=O)(=O)O |
| InChI | InChI=1S/C10H25N3O6S2/c11-3-1-4-12-5-2-6-13(7-9-20(14,15)16)8-10-21(17,18)19/h12H,1-11H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | CYUUKOSAFOCEGU-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|