C8H19FN2O5S2 — CID 140799673
3-[3-(fluorosulfonylamino)propyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 140799673) has the molecular formula C8H19FN2O5S2 and a molecular weight of 306.38 g/mol. Its IUPAC name is 3-[3-(fluorosulfonylamino)propyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[3-(fluorosulfonylamino)propyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 140799673 |
| Molecular Formula | C8H19FN2O5S2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-[3-(fluorosulfonylamino)propyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | C[N+](C)(CCCNS(=O)(=O)F)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H19FN2O5S2/c1-11(2,7-4-8-17(12,13)14)6-3-5-10-18(9,15)16/h10H,3-8H2,1-2H3 |
| InChIKey | OSXSQBLJARFYDM-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|