C9H21FN2O5S2 — CID 140799660
4-[3-(fluorosulfonylamino)propyl-dimethylazaniumyl]butane-2-sulfonate (PubChem CID 140799660) has the molecular formula C9H21FN2O5S2 and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-[3-(fluorosulfonylamino)propyl-dimethylazaniumyl]butane-2-sulfonate.
| Compound Name | 4-[3-(fluorosulfonylamino)propyl-dimethylazaniumyl]butane-2-sulfonate |
|---|---|
| PubChem CID | 140799660 |
| Molecular Formula | C9H21FN2O5S2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4-[3-(fluorosulfonylamino)propyl-dimethylazaniumyl]butane-2-sulfonate |
| SMILES | CC(CC[N+](C)(C)CCCNS(=O)(=O)F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H21FN2O5S2/c1-9(18(13,14)15)5-8-12(2,3)7-4-6-11-19(10,16)17/h9,11H,4-8H2,1-3H3 |
| InChIKey | WLFJKSBAOMAHFQ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|