C12H30N2O6S2 — CID 54209441
3-[ethyl(methyl)azaniumyl]propane-1-sulfonate;3-(trimethylazaniumyl)propane-1-sulfonate (PubChem CID 54209441) has the molecular formula C12H30N2O6S2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 3-[ethyl(methyl)azaniumyl]propane-1-sulfonate;3-(trimethylazaniumyl)propane-1-sulfonate.
| Compound Name | 3-[ethyl(methyl)azaniumyl]propane-1-sulfonate;3-(trimethylazaniumyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 54209441 |
| Molecular Formula | C12H30N2O6S2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-[ethyl(methyl)azaniumyl]propane-1-sulfonate;3-(trimethylazaniumyl)propane-1-sulfonate |
| SMILES | CC[NH+](C)CCCS(=O)(=O)[O-].C[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/2C6H15NO3S/c1-7(2,3)5-4-6-11(8,9)10;1-3-7(2)5-4-6-11(8,9)10/h4-6H2,1-3H3;3-6H2,1-2H3,(H,8,9,10) |
| InChIKey | PUWWRFBYYICUNZ-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|