About ethyl(dimethyl)azanium;propane-1-sulfonate
ethyl(dimethyl)azanium;propane-1-sulfonate (PubChem CID 22926486) has the molecular formula C7H19NO3S
and a molecular weight of 197.30 g/mol. Its IUPAC name is ethyl(dimethyl)azanium;propane-1-sulfonate.
Molecular Properties
| Compound Name | ethyl(dimethyl)azanium;propane-1-sulfonate |
| PubChem CID | 22926486 |
| Molecular Formula | C7H19NO3S |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | ethyl(dimethyl)azanium;propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)[O-].CC[NH+](C)C |
| InChI | InChI=1S/C4H11N.C3H8O3S/c1-4-5(2)3;1-2-3-7(4,5)6/h4H2,1-3H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | LKJLUHOHYDJLFF-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl(dimethyl)azanium;propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(dimethyl)azanium;propane-1-sulfonate?
The IUPAC name of ethyl(dimethyl)azanium;propane-1-sulfonate (CID 22926486) is ethyl(dimethyl)azanium;propane-1-sulfonate.
What is the SMILES notation for ethyl(dimethyl)azanium;propane-1-sulfonate?
The canonical SMILES for ethyl(dimethyl)azanium;propane-1-sulfonate is CCCS(=O)(=O)[O-].CC[NH+](C)C.
What is the InChIKey of ethyl(dimethyl)azanium;propane-1-sulfonate?
The InChIKey is LKJLUHOHYDJLFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.C3H8O3S/c1-4-5(2)3;1-2-3-7(4,5)6/h4H2,1-3H3;2-3H2,1H3,(H,4,5,6).
What are the key properties of ethyl(dimethyl)azanium;propane-1-sulfonate?
ethyl(dimethyl)azanium;propane-1-sulfonate has a molecular weight of 197.30 g/mol, XLogP of -0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(dimethyl)azanium;propane-1-sulfonate is sourced from PubChem (CID 22926486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).