C10H20F5N2O5S2+ — CID 163324427
dimethyl-[3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl]-(3-sulfopropyl)azanium (PubChem CID 163324427) has the molecular formula C10H20F5N2O5S2+ and a molecular weight of 407.40 g/mol. Its IUPAC name is dimethyl-[3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl]-(3-sulfopropyl)azanium.
| Compound Name | dimethyl-[3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 163324427 |
| Molecular Formula | C10H20F5N2O5S2+ |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | dimethyl-[3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl]-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C10H19F5N2O5S2/c1-17(2,7-4-8-23(18,19)20)6-3-5-16-24(21,22)10(14,15)9(11,12)13/h16H,3-8H2,1-2H3/p+1 |
| InChIKey | GDVFZOZBFJNYEM-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|