C13H22F9N2O5S2+ — CID 139594229
dimethyl-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]-(3-sulfopropyl)azanium (PubChem CID 139594229) has the molecular formula C13H22F9N2O5S2+ and a molecular weight of 521.44 g/mol. Its IUPAC name is dimethyl-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]-(3-sulfopropyl)azanium.
| Compound Name | dimethyl-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 139594229 |
| Molecular Formula | C13H22F9N2O5S2+ |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | dimethyl-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]-(3-sulfopropyl)azanium |
| SMILES | CN(CCC[N+](C)(C)CCCS(=O)(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H21F9N2O5S2/c1-23(6-4-7-24(2,3)8-5-9-30(25,26)27)31(28,29)13(21,22)11(16,17)10(14,15)12(18,19)20/h4-9H2,1-3H3/p+1 |
| InChIKey | ASTROXKUROKGII-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|