C9H14ClNOS — CID 140583009
2-chloro-3,3-dimethyl-2-methylsulfanylhex-4-ynamide (PubChem CID 140583009) has the molecular formula C9H14ClNOS and a molecular weight of 219.74 g/mol. Its IUPAC name is 2-chloro-3,3-dimethyl-2-methylsulfanylhex-4-ynamide.
| Compound Name | 2-chloro-3,3-dimethyl-2-methylsulfanylhex-4-ynamide |
|---|---|
| PubChem CID | 140583009 |
| Molecular Formula | C9H14ClNOS |
| Molecular Weight | 219.74 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-chloro-3,3-dimethyl-2-methylsulfanylhex-4-ynamide |
| SMILES | CC#CC(C)(C)C(Cl)(SC)C(N)=O |
| InChI | InChI=1S/C9H14ClNOS/c1-5-6-8(2,3)9(10,13-4)7(11)12/h1-4H3,(H2,11,12) |
| InChIKey | XZGAGABCXJIGBR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.74 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|