C13H24 — CID 58944279
4,4,5,5,6,6-hexamethylhept-2-yne (PubChem CID 58944279) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexamethylhept-2-yne.
| Compound Name | 4,4,5,5,6,6-hexamethylhept-2-yne |
|---|---|
| PubChem CID | 58944279 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 4,4,5,5,6,6-hexamethylhept-2-yne |
| SMILES | CC#CC(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24/c1-9-10-12(5,6)13(7,8)11(2,3)4/h1-8H3 |
| InChIKey | DOUCHVRYGMTNPJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|