C14H32N2O4 — CID 140586071
1,2,2,2-tetrapropoxyethane-1,1-diamine (PubChem CID 140586071) has the molecular formula C14H32N2O4 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1,2,2,2-tetrapropoxyethane-1,1-diamine.
| Compound Name | 1,2,2,2-tetrapropoxyethane-1,1-diamine |
|---|---|
| PubChem CID | 140586071 |
| Molecular Formula | C14H32N2O4 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1,2,2,2-tetrapropoxyethane-1,1-diamine |
| SMILES | CCCOC(N)(N)C(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C14H32N2O4/c1-5-9-17-13(15,16)14(18-10-6-2,19-11-7-3)20-12-8-4/h5-12,15-16H2,1-4H3 |
| InChIKey | NUOOZAIXHCTCAC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|