C18H42O4Si2 — CID 173016785
1,1-dipropoxyethyl-[2-(1,1-dipropoxyethylsilyl)ethyl]silane (PubChem CID 173016785) has the molecular formula C18H42O4Si2 and a molecular weight of 378.70 g/mol. Its IUPAC name is 1,1-dipropoxyethyl-[2-(1,1-dipropoxyethylsilyl)ethyl]silane.
| Compound Name | 1,1-dipropoxyethyl-[2-(1,1-dipropoxyethylsilyl)ethyl]silane |
|---|---|
| PubChem CID | 173016785 |
| Molecular Formula | C18H42O4Si2 |
| Molecular Weight | 378.70 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 1,1-dipropoxyethyl-[2-(1,1-dipropoxyethylsilyl)ethyl]silane |
| SMILES | CCCOC(C)(OCCC)[SiH2]CC[SiH2]C(C)(OCCC)OCCC |
| InChI | InChI=1S/C18H42O4Si2/c1-7-11-19-17(5,20-12-8-2)23-15-16-24-18(6,21-13-9-3)22-14-10-4/h7-16,23-24H2,1-6H3 |
| InChIKey | KILKBJXBMXQKRT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|