C31H34Si — CID 140588913
(2-methyl-2,3,3a,4-tetrahydro-1H-inden-1-yl)-tris(3-methylphenyl)silane (PubChem CID 140588913) has the molecular formula C31H34Si and a molecular weight of 434.70 g/mol. Its IUPAC name is (2-methyl-2,3,3a,4-tetrahydro-1H-inden-1-yl)-tris(3-methylphenyl)silane.
| Compound Name | (2-methyl-2,3,3a,4-tetrahydro-1H-inden-1-yl)-tris(3-methylphenyl)silane |
|---|---|
| PubChem CID | 140588913 |
| Molecular Formula | C31H34Si |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (2-methyl-2,3,3a,4-tetrahydro-1H-inden-1-yl)-tris(3-methylphenyl)silane |
| SMILES | Cc1cccc([Si](c2cccc(C)c2)(c2cccc(C)c2)C2C3=CC=CCC3CC2C)c1 |
| InChI | InChI=1S/C31H34Si/c1-22-10-7-14-27(18-22)32(28-15-8-11-23(2)19-28,29-16-9-12-24(3)20-29)31-25(4)21-26-13-5-6-17-30(26)31/h5-12,14-20,25-26,31H,13,21H2,1-4H3 |
| InChIKey | XRHJLTJYSDJZBU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|