C4H9F3NO2S+ — CID 140591681
2-(2,2,2-trifluoroethylsulfonyl)ethylazanium (PubChem CID 140591681) has the molecular formula C4H9F3NO2S+ and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfonyl)ethylazanium.
| Compound Name | 2-(2,2,2-trifluoroethylsulfonyl)ethylazanium |
|---|---|
| PubChem CID | 140591681 |
| Molecular Formula | C4H9F3NO2S+ |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfonyl)ethylazanium |
| SMILES | [NH3+]CCS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C4H8F3NO2S/c5-4(6,7)3-11(9,10)2-1-8/h1-3,8H2/p+1 |
| InChIKey | LCAFKXUREMWCMM-UHFFFAOYSA-O |
| XLogP | -0.79 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |