C12H13F7O2 — CID 140592110
1,1,2,2,3,3,3-heptafluoropropyl 2-cyclohexylprop-2-enoate (PubChem CID 140592110) has the molecular formula C12H13F7O2 and a molecular weight of 322.22 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropyl 2-cyclohexylprop-2-enoate.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropyl 2-cyclohexylprop-2-enoate |
|---|---|
| PubChem CID | 140592110 |
| Molecular Formula | C12H13F7O2 |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropyl 2-cyclohexylprop-2-enoate |
| SMILES | C=C(C(=O)OC(F)(F)C(F)(F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C12H13F7O2/c1-7(8-5-3-2-4-6-8)9(20)21-12(18,19)10(13,14)11(15,16)17/h8H,1-6H2 |
| InChIKey | AVBPZQBLYCBEHF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|