C23H29GeN — CID 140592731
[2-(3,5-dimethylphenyl)quinolin-7-yl]-triethylgermane (PubChem CID 140592731) has the molecular formula C23H29GeN and a molecular weight of 392.10 g/mol. Its IUPAC name is [2-(3,5-dimethylphenyl)quinolin-7-yl]-triethylgermane.
| Compound Name | [2-(3,5-dimethylphenyl)quinolin-7-yl]-triethylgermane |
|---|---|
| PubChem CID | 140592731 |
| Molecular Formula | C23H29GeN |
| Molecular Weight | 392.10 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [2-(3,5-dimethylphenyl)quinolin-7-yl]-triethylgermane |
| SMILES | CC[Ge](CC)(CC)c1ccc2ccc(-c3cc(C)cc(C)c3)nc2c1 |
| InChI | InChI=1S/C23H29GeN/c1-6-24(7-2,8-3)21-11-9-19-10-12-22(25-23(19)16-21)20-14-17(4)13-18(5)15-20/h9-16H,6-8H2,1-5H3 |
| InChIKey | MYRMKCYTPQCJSC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.10 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |