C56H60N4Si — CID 140593883
bis[3-[5-[2,6-di(propan-2-yl)phenyl]-1-phenylimidazol-2-yl]phenyl]-dimethylsilane (PubChem CID 140593883) has the molecular formula C56H60N4Si and a molecular weight of 817.21 g/mol. Its IUPAC name is bis[3-[5-[2,6-di(propan-2-yl)phenyl]-1-phenylimidazol-2-yl]phenyl]-dimethylsilane.
| Compound Name | bis[3-[5-[2,6-di(propan-2-yl)phenyl]-1-phenylimidazol-2-yl]phenyl]-dimethylsilane |
|---|---|
| PubChem CID | 140593883 |
| Molecular Formula | C56H60N4Si |
| Molecular Weight | 817.21 g/mol |
| Exact Mass | 816.46 |
| IUPAC Name | bis[3-[5-[2,6-di(propan-2-yl)phenyl]-1-phenylimidazol-2-yl]phenyl]-dimethylsilane |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnc(-c2cccc([Si](C)(C)c3cccc(-c4ncc(-c5c(C(C)C)cccc5C(C)C)n4-c4ccccc4)c3)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C56H60N4Si/c1-37(2)47-29-19-30-48(38(3)4)53(47)51-35-57-55(59(51)43-23-13-11-14-24-43)41-21-17-27-45(33-41)61(9,10)46-28-18-22-42(34-46)56-58-36-52(60(56)44-25-15-12-16-26-44)54-49(39(5)6)31-20-32-50(54)40(7)8/h11-40H,1-10H3 |
| InChIKey | YIMPKSORHQOZQT-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.21 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|