About 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole
1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole (PubChem CID 135344077) has the molecular formula C21H23BrN2
and a molecular weight of 383.33 g/mol. Its IUPAC name is 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole.
Molecular Properties
| Compound Name | 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole |
| PubChem CID | 135344077 |
| Molecular Formula | C21H23BrN2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnn(-c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C21H23BrN2/c1-14(2)19-9-6-10-20(15(3)4)21(19)16-12-23-24(13-16)18-8-5-7-17(22)11-18/h5-15H,1-4H3 |
| InChIKey | NBWFYMYQOLUMOE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole?
The IUPAC name of 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole (CID 135344077) is 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole.
What is the SMILES notation for 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole?
The canonical SMILES for 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole is CC(C)c1cccc(C(C)C)c1-c1cnn(-c2cccc(Br)c2)c1.
What is the InChIKey of 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole?
The InChIKey is NBWFYMYQOLUMOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23BrN2/c1-14(2)19-9-6-10-20(15(3)4)21(19)16-12-23-24(13-16)18-8-5-7-17(22)11-18/h5-15H,1-4H3.
What are the key properties of 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole?
1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole has a molecular weight of 383.33 g/mol, XLogP of 6.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromophenyl)-4-[2,6-di(propan-2-yl)phenyl]pyrazole is sourced from PubChem (CID 135344077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).