C30H31BN3 — CID 175329232
CID 175329232 (PubChem CID 175329232) has the molecular formula C30H31BN3 and a molecular weight of 444.41 g/mol.
| Compound Name | CID 175329232 |
|---|---|
| PubChem CID | 175329232 |
| Molecular Formula | C30H31BN3 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnn(-c2cccc(C3(c4ccccc4)[B]NC=C3)c2)c1 |
| InChI | InChI=1S/C30H31BN3/c1-21(2)27-14-9-15-28(22(3)4)29(27)23-19-33-34(20-23)26-13-8-12-25(18-26)30(16-17-32-31-30)24-10-6-5-7-11-24/h5-22,32H,1-4H3 |
| InChIKey | FUJAQSVPVJMROX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|