C54H49N5OPt — CID 156627382
CID 156627382 (PubChem CID 156627382) has the molecular formula C54H49N5OPt and a molecular weight of 979.10 g/mol.
| Compound Name | CID 156627382 |
|---|---|
| PubChem CID | 156627382 |
| Molecular Formula | C54H49N5OPt |
| Molecular Weight | 979.10 g/mol |
| Exact Mass | 978.36 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnn(-c2[c-]c3c(cc2)oc2ccc4c(c5[c-]c(-n6cc(-c7c(C(C)C)cccc7C(C)C)cn6)ccc5n4-c4ccccc4)c23)c1.[Pt+2] |
| InChI | InChI=1S/C54H49N5O.Pt/c1-32(2)41-16-12-17-42(33(3)4)51(41)36-28-55-57(30-36)39-20-22-47-45(26-39)53-48(59(47)38-14-10-9-11-15-38)23-25-50-54(53)46-27-40(21-24-49(46)60-50)58-31-37(29-56-58)52-43(34(5)6)18-13-19-44(52)35(7)8;/h9-25,28-35H,1-8H3;/q-2;+2 |
| InChIKey | MLVONCWULPAWSB-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 53.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.10 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|