C7H8KN3O — CID 140598754
potassium 2,2-dicyano-1-(propylamino)ethenolate (PubChem CID 140598754) has the molecular formula C7H8KN3O and a molecular weight of 189.26 g/mol. Its IUPAC name is potassium 2,2-dicyano-1-(propylamino)ethenolate.
| Compound Name | potassium 2,2-dicyano-1-(propylamino)ethenolate |
|---|---|
| PubChem CID | 140598754 |
| Molecular Formula | C7H8KN3O |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | potassium 2,2-dicyano-1-(propylamino)ethenolate |
| SMILES | CCCNC([O-])=C(C#N)C#N.[K+] |
| InChI | InChI=1S/C7H9N3O.K/c1-2-3-10-7(11)6(4-8)5-9;/h10-11H,2-3H2,1H3;/q;+1/p-1 |
| InChIKey | ZQROYUZCBVIJRQ-UHFFFAOYSA-M |
| XLogP | -3.39 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|