C13H16CuFN2 — CID 140599675
fluorocopper;1-methyl-3-(2,4,6-trimethylphenyl)pyrazole (PubChem CID 140599675) has the molecular formula C13H16CuFN2 and a molecular weight of 282.83 g/mol. Its IUPAC name is fluorocopper;1-methyl-3-(2,4,6-trimethylphenyl)pyrazole.
| Compound Name | fluorocopper;1-methyl-3-(2,4,6-trimethylphenyl)pyrazole |
|---|---|
| PubChem CID | 140599675 |
| Molecular Formula | C13H16CuFN2 |
| Molecular Weight | 282.83 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | fluorocopper;1-methyl-3-(2,4,6-trimethylphenyl)pyrazole |
| SMILES | Cc1cc(C)c(-c2ccn(C)n2)c(C)c1.F[Cu] |
| InChI | InChI=1S/C13H16N2.Cu.FH/c1-9-7-10(2)13(11(3)8-9)12-5-6-15(4)14-12;;/h5-8H,1-4H3;;1H/q;+1;/p-1 |
| InChIKey | SIYJUOQOAIAMDS-UHFFFAOYSA-M |
| XLogP | 3.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |