C10H8Cl2N2 — CID 173078305
3-(2,6-dichlorophenyl)-1-methylpyrazole (PubChem CID 173078305) has the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1-methylpyrazole.
| Compound Name | 3-(2,6-dichlorophenyl)-1-methylpyrazole |
|---|---|
| PubChem CID | 173078305 |
| Molecular Formula | C10H8Cl2N2 |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1-methylpyrazole |
| SMILES | Cn1ccc(-c2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C10H8Cl2N2/c1-14-6-5-9(13-14)10-7(11)3-2-4-8(10)12/h2-6H,1H3 |
| InChIKey | LIRNADAMTSHXIG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |