C11H8Cl2N2O2 — CID 142642830
2,4-dichloro-3-(1-methylpyrazol-3-yl)benzoic acid (PubChem CID 142642830) has the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. Its IUPAC name is 2,4-dichloro-3-(1-methylpyrazol-3-yl)benzoic acid.
| Compound Name | 2,4-dichloro-3-(1-methylpyrazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 142642830 |
| Molecular Formula | C11H8Cl2N2O2 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 2,4-dichloro-3-(1-methylpyrazol-3-yl)benzoic acid |
| SMILES | Cn1ccc(-c2c(Cl)ccc(C(=O)O)c2Cl)n1 |
| InChI | InChI=1S/C11H8Cl2N2O2/c1-15-5-4-8(14-15)9-7(12)3-2-6(10(9)13)11(16)17/h2-5H,1H3,(H,16,17) |
| InChIKey | KKDKMAXJOZIITK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |