C8H7N3O3 — CID 103122282
2-(1-methylpyrazol-3-yl)-1,3-oxazole-4-carboxylic acid (PubChem CID 103122282) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-(1-methylpyrazol-3-yl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(1-methylpyrazol-3-yl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103122282 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-(1-methylpyrazol-3-yl)-1,3-oxazole-4-carboxylic acid |
| SMILES | Cn1ccc(-c2nc(C(=O)O)co2)n1 |
| InChI | InChI=1S/C8H7N3O3/c1-11-3-2-5(10-11)7-9-6(4-14-7)8(12)13/h2-4H,1H3,(H,12,13) |
| InChIKey | CQYVTIJCRYIZMH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |