C7H11NO3 — CID 144678746
ethane;2-methyl-1,3-oxazole-4-carboxylic acid (PubChem CID 144678746) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is ethane;2-methyl-1,3-oxazole-4-carboxylic acid.
| Compound Name | ethane;2-methyl-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 144678746 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | ethane;2-methyl-1,3-oxazole-4-carboxylic acid |
| SMILES | CC.Cc1nc(C(=O)O)co1 |
| InChI | InChI=1S/C5H5NO3.C2H6/c1-3-6-4(2-9-3)5(7)8;1-2/h2H,1H3,(H,7,8);1-2H3 |
| InChIKey | UNSWRBLCRUXYMT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |