ethane;2-methyl-1,3-oxazole-4-carboxylic acid

C7H11NO3 — CID 144678746

IUPACethane;2-methyl-1,3-oxazole-4-carboxylic acid
SMILESCC.Cc1nc(C(=O)O)co1
InChIInChI=1S/C5H5NO3.C2H6/c1-3-6-4(2-9-3)5(7)8;1-2/h2H,1H3,(H,7,8);1-2H3
InChIKeyUNSWRBLCRUXYMT-UHFFFAOYSA-N
MW157.17 g/mol
LogP1.71
Rot. Bonds1

About ethane;2-methyl-1,3-oxazole-4-carboxylic acid

ethane;2-methyl-1,3-oxazole-4-carboxylic acid (PubChem CID 144678746) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is ethane;2-methyl-1,3-oxazole-4-carboxylic acid.

Molecular Properties

Compound Nameethane;2-methyl-1,3-oxazole-4-carboxylic acid
PubChem CID144678746
Molecular FormulaC7H11NO3
Molecular Weight157.17 g/mol
Exact Mass157.07
IUPAC Nameethane;2-methyl-1,3-oxazole-4-carboxylic acid
SMILESCC.Cc1nc(C(=O)O)co1
InChIInChI=1S/C5H5NO3.C2H6/c1-3-6-4(2-9-3)5(7)8;1-2/h2H,1H3,(H,7,8);1-2H3
InChIKeyUNSWRBLCRUXYMT-UHFFFAOYSA-N
XLogP1.71
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.17
LogP ≤ 51.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze ethane;2-methyl-1,3-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-methyl-1,3-oxazole-4-carboxylic acid?
The IUPAC name of ethane;2-methyl-1,3-oxazole-4-carboxylic acid (CID 144678746) is ethane;2-methyl-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for ethane;2-methyl-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for ethane;2-methyl-1,3-oxazole-4-carboxylic acid is CC.Cc1nc(C(=O)O)co1.
What is the InChIKey of ethane;2-methyl-1,3-oxazole-4-carboxylic acid?
The InChIKey is UNSWRBLCRUXYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3.C2H6/c1-3-6-4(2-9-3)5(7)8;1-2/h2H,1H3,(H,7,8);1-2H3.
What are the key properties of ethane;2-methyl-1,3-oxazole-4-carboxylic acid?
ethane;2-methyl-1,3-oxazole-4-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 144678746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).