C21H29FN6O2 — CID 140599816
4-[(2R)-4-tert-butylpiperazine-2-carbonyl]-N-(3-fluoro-4-isocyanophenyl)piperazine-1-carboxamide (PubChem CID 140599816) has the molecular formula C21H29FN6O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-[(2R)-4-tert-butylpiperazine-2-carbonyl]-N-(3-fluoro-4-isocyanophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[(2R)-4-tert-butylpiperazine-2-carbonyl]-N-(3-fluoro-4-isocyanophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140599816 |
| Molecular Formula | C21H29FN6O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 4-[(2R)-4-tert-butylpiperazine-2-carbonyl]-N-(3-fluoro-4-isocyanophenyl)piperazine-1-carboxamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)N2CCN(C(=O)[C@H]3CN(C(C)(C)C)CCN3)CC2)cc1F |
| InChI | InChI=1S/C21H29FN6O2/c1-21(2,3)28-8-7-24-18(14-28)19(29)26-9-11-27(12-10-26)20(30)25-15-5-6-17(23-4)16(22)13-15/h5-6,13,18,24H,7-12,14H2,1-3H3,(H,25,30)/t18-/m1/s1 |
| InChIKey | HPLUAWDHSWPECX-GOSISDBHSA-N |
| XLogP | 2.12 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|