C32H21LiN3O+ — CID 140600455
lithium 7-[4-(1-phenylbenzimidazol-2-yl)naphthalen-1-yl]quinolin-1-ium-8-olate (PubChem CID 140600455) has the molecular formula C32H21LiN3O+ and a molecular weight of 470.48 g/mol. Its IUPAC name is lithium 7-[4-(1-phenylbenzimidazol-2-yl)naphthalen-1-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 7-[4-(1-phenylbenzimidazol-2-yl)naphthalen-1-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600455 |
| Molecular Formula | C32H21LiN3O+ |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | lithium 7-[4-(1-phenylbenzimidazol-2-yl)naphthalen-1-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1c(-c2ccc(-c3nc4ccccc4n3-c3ccccc3)c3ccccc23)ccc2ccc[nH+]c12 |
| InChI | InChI=1S/C32H21N3O.Li/c36-31-26(17-16-21-9-8-20-33-30(21)31)25-18-19-27(24-13-5-4-12-23(24)25)32-34-28-14-6-7-15-29(28)35(32)22-10-2-1-3-11-22;/h1-20,36H;/q;+1 |
| InChIKey | UDYQDPMCMJUZDC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |