C27H21FN4O2 — CID 91170969
5-(1H-benzimidazol-2-ylmethyl)-3-[(4-fluorophenyl)methyl]-7-methylpyrrolo[3,4-g]quinoline-8,9-diol (PubChem CID 91170969) has the molecular formula C27H21FN4O2 and a molecular weight of 452.49 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-ylmethyl)-3-[(4-fluorophenyl)methyl]-7-methylpyrrolo[3,4-g]quinoline-8,9-diol.
| Compound Name | 5-(1H-benzimidazol-2-ylmethyl)-3-[(4-fluorophenyl)methyl]-7-methylpyrrolo[3,4-g]quinoline-8,9-diol |
|---|---|
| PubChem CID | 91170969 |
| Molecular Formula | C27H21FN4O2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 5-(1H-benzimidazol-2-ylmethyl)-3-[(4-fluorophenyl)methyl]-7-methylpyrrolo[3,4-g]quinoline-8,9-diol |
| SMILES | Cn1cc2c(Cc3nc4ccccc4[nH]3)c3cc(Cc4ccc(F)cc4)cnc3c(O)c2c1O |
| InChI | InChI=1S/C27H21FN4O2/c1-32-14-20-18(12-23-30-21-4-2-3-5-22(21)31-23)19-11-16(10-15-6-8-17(28)9-7-15)13-29-25(19)26(33)24(20)27(32)34/h2-9,11,13-14,33-34H,10,12H2,1H3,(H,30,31) |
| InChIKey | WMNBCWZXZPPEQP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|