C30H20LiN4O+ — CID 140600457
lithium 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-1-ium-8-olate (PubChem CID 140600457) has the molecular formula C30H20LiN4O+ and a molecular weight of 459.46 g/mol. Its IUPAC name is lithium 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-1-ium-8-olate.
| Compound Name | lithium 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600457 |
| Molecular Formula | C30H20LiN4O+ |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | lithium 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c2ccc[nH+]c12 |
| InChI | InChI=1S/C30H20N4O.Li/c35-26-18-17-24(25-12-7-19-31-27(25)26)20-13-15-23(16-14-20)30-33-28(21-8-3-1-4-9-21)32-29(34-30)22-10-5-2-6-11-22;/h1-19,35H;/q;+1 |
| InChIKey | CCWVSWKPKVMUKW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |