C36H22LiN2OS+ — CID 140600465
lithium 7-[3-[4-(1,3-benzothiazol-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate (PubChem CID 140600465) has the molecular formula C36H22LiN2OS+ and a molecular weight of 537.59 g/mol. Its IUPAC name is lithium 7-[3-[4-(1,3-benzothiazol-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 7-[3-[4-(1,3-benzothiazol-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600465 |
| Molecular Formula | C36H22LiN2OS+ |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | lithium 7-[3-[4-(1,3-benzothiazol-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1c(-c2c3ccccc3cc3cc(-c4ccc(-c5nc6ccccc6s5)cc4)ccc23)ccc2ccc[nH+]c12 |
| InChI | InChI=1S/C36H22N2OS.Li/c39-35-30(18-15-23-7-5-19-37-34(23)35)33-28-8-2-1-6-26(28)21-27-20-25(16-17-29(27)33)22-11-13-24(14-12-22)36-38-31-9-3-4-10-32(31)40-36;/h1-21,39H;/q;+1 |
| InChIKey | CYTRKNBCMOGOAX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|