C26H18BeN2OS2+2 — CID 59219775
beryllium;benzo[h]quinolin-1-ium-10-olate;2-(1,3-benzothiazol-3-ium-2-yl)benzenethiolate (PubChem CID 59219775) has the molecular formula C26H18BeN2OS2+2 and a molecular weight of 447.59 g/mol. Its IUPAC name is beryllium;benzo[h]quinolin-1-ium-10-olate;2-(1,3-benzothiazol-3-ium-2-yl)benzenethiolate.
| Compound Name | beryllium;benzo[h]quinolin-1-ium-10-olate;2-(1,3-benzothiazol-3-ium-2-yl)benzenethiolate |
|---|---|
| PubChem CID | 59219775 |
| Molecular Formula | C26H18BeN2OS2+2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | beryllium;benzo[h]quinolin-1-ium-10-olate;2-(1,3-benzothiazol-3-ium-2-yl)benzenethiolate |
| SMILES | [Be+2].[O-]c1cccc2ccc3ccc[nH+]c3c12.[S-]c1ccccc1-c1[nH+]c2ccccc2s1 |
| InChI | InChI=1S/C13H9NO.C13H9NS2.Be/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;/h1-8,15H;1-8,15H;/q;;+2 |
| InChIKey | CEUFWHPRIDDWHG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 51.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|