C26H18MgN2O2S2+2 — CID 140661110
magnesium bis(2-(1,3-benzothiazol-3-ium-2-yl)phenolate) (PubChem CID 140661110) has the molecular formula C26H18MgN2O2S2+2 and a molecular weight of 478.88 g/mol. Its IUPAC name is magnesium bis(2-(1,3-benzothiazol-3-ium-2-yl)phenolate).
| Compound Name | magnesium bis(2-(1,3-benzothiazol-3-ium-2-yl)phenolate) |
|---|---|
| PubChem CID | 140661110 |
| Molecular Formula | C26H18MgN2O2S2+2 |
| Molecular Weight | 478.88 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | magnesium bis(2-(1,3-benzothiazol-3-ium-2-yl)phenolate) |
| SMILES | [Mg+2].[O-]c1ccccc1-c1[nH+]c2ccccc2s1.[O-]c1ccccc1-c1[nH+]c2ccccc2s1 |
| InChI | InChI=1S/2C13H9NOS.Mg/c2*15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;/h2*1-8,15H;/q;;+2 |
| InChIKey | WGSXBSBHMRARIY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |