C9H8NS+ — CID 59991217
2-ethenyl-1,3-benzothiazol-3-ium (PubChem CID 59991217) has the molecular formula C9H8NS+ and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-ethenyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-ethenyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 59991217 |
| Molecular Formula | C9H8NS+ |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 2-ethenyl-1,3-benzothiazol-3-ium |
| SMILES | C=Cc1[nH+]c2ccccc2s1 |
| InChI | InChI=1S/C9H7NS/c1-2-9-10-7-5-3-4-6-8(7)11-9/h2-6H,1H2/p+1 |
| InChIKey | BNNNAVQJVYKEHQ-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |