C18H14ClNS — CID 67789940
2-(naphthalen-1-ylmethyl)-1,3-benzothiazol-3-ium chloride (PubChem CID 67789940) has the molecular formula C18H14ClNS and a molecular weight of 311.84 g/mol. Its IUPAC name is 2-(naphthalen-1-ylmethyl)-1,3-benzothiazol-3-ium chloride.
| Compound Name | 2-(naphthalen-1-ylmethyl)-1,3-benzothiazol-3-ium chloride |
|---|---|
| PubChem CID | 67789940 |
| Molecular Formula | C18H14ClNS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-(naphthalen-1-ylmethyl)-1,3-benzothiazol-3-ium chloride |
| SMILES | [Cl-].c1ccc2c(Cc3[nH+]c4ccccc4s3)cccc2c1 |
| InChI | InChI=1S/C18H13NS.ClH/c1-2-9-15-13(6-1)7-5-8-14(15)12-18-19-16-10-3-4-11-17(16)20-18;/h1-11H,12H2;1H |
| InChIKey | QVSAVDWFXUKYHW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |