C22H16Li2N2O2S+2 — CID 161035519
dilithium;2-(1,3-benzothiazol-3-ium-2-yl)phenolate;quinolin-1-ium-8-olate (PubChem CID 161035519) has the molecular formula C22H16Li2N2O2S+2 and a molecular weight of 386.33 g/mol. Its IUPAC name is dilithium;2-(1,3-benzothiazol-3-ium-2-yl)phenolate;quinolin-1-ium-8-olate.
| Compound Name | dilithium;2-(1,3-benzothiazol-3-ium-2-yl)phenolate;quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 161035519 |
| Molecular Formula | C22H16Li2N2O2S+2 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | dilithium;2-(1,3-benzothiazol-3-ium-2-yl)phenolate;quinolin-1-ium-8-olate |
| SMILES | [Li+].[Li+].[O-]c1cccc2ccc[nH+]c12.[O-]c1ccccc1-c1[nH+]c2ccccc2s1 |
| InChI | InChI=1S/C13H9NOS.C9H7NO.2Li/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;11-8-5-1-3-7-4-2-6-10-9(7)8;;/h1-8,15H;1-6,11H;;/q;;2*+1 |
| InChIKey | UAEVUFVDJUQWEM-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 74.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |