About beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate
beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate (PubChem CID 143983785) has the molecular formula C27H20BeN2O2+2
and a molecular weight of 413.48 g/mol. Its IUPAC name is beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate.
Molecular Properties
| Compound Name | beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate |
| PubChem CID | 143983785 |
| Molecular Formula | C27H20BeN2O2+2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate |
| SMILES | [Be+2].[O-]C1=c2c(ccc3ccc[nH+]c23)=CCC=C1.[O-]c1cccc2ccc3ccc[nH+]c3c12 |
| InChI | InChI=1S/C14H11NO.C13H9NO.Be/c16-12-6-2-1-4-10-7-8-11-5-3-9-15-14(11)13(10)12;15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;/h2-9,16H,1H2;1-8,15H;/q;;+2 |
| InChIKey | ADQGWECOTWLQTP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate?
The IUPAC name of beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate (CID 143983785) is beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate.
What is the SMILES notation for beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate?
The canonical SMILES for beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate is [Be+2].[O-]C1=c2c(ccc3ccc[nH+]c23)=CCC=C1.[O-]c1cccc2ccc3ccc[nH+]c3c12.
What is the InChIKey of beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate?
The InChIKey is ADQGWECOTWLQTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO.C13H9NO.Be/c16-12-6-2-1-4-10-7-8-11-5-3-9-15-14(11)13(10)12;15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;/h2-9,16H,1H2;1-8,15H;/q;;+2.
What are the key properties of beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate?
beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate has a molecular weight of 413.48 g/mol, XLogP of 1.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium;benzo[h]quinolin-1-ium-10-olate;8H-cyclohepta[h]quinolin-1-ium-11-olate is sourced from PubChem (CID 143983785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).